C19H26BrN3 — CID 123318457
2-(6-bromo-3',5'-dimethylspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-yl)iminopropanimidamide (PubChem CID 123318457) has the molecular formula C19H26BrN3 and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-(6-bromo-3',5'-dimethylspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-yl)iminopropanimidamide.
| Compound Name | 2-(6-bromo-3',5'-dimethylspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-yl)iminopropanimidamide |
|---|---|
| PubChem CID | 123318457 |
| Molecular Formula | C19H26BrN3 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-(6-bromo-3',5'-dimethylspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-yl)iminopropanimidamide |
| SMILES | [H]/N=C(N)/C(C)=N/C1c2cc(Br)ccc2CC12CC(C)CC(C)C2 |
| InChI | InChI=1S/C19H26BrN3/c1-11-6-12(2)9-19(8-11)10-14-4-5-15(20)7-16(14)17(19)23-13(3)18(21)22/h4-5,7,11-12,17H,6,8-10H2,1-3H3,(H3,21,22)/b23-13+ |
| InChIKey | ADAJSKCZWSENIO-YDZHTSKRSA-N |
| XLogP | 4.89 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|