C24H38N2 — CID 123318542
1-(2,4,5,6-tetramethylcyclohexa-1,5-dien-1-yl)-3-(2,5,7-trimethylocta-1,4,6-trien-3-yl)imidazolidine (PubChem CID 123318542) has the molecular formula C24H38N2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 1-(2,4,5,6-tetramethylcyclohexa-1,5-dien-1-yl)-3-(2,5,7-trimethylocta-1,4,6-trien-3-yl)imidazolidine.
| Compound Name | 1-(2,4,5,6-tetramethylcyclohexa-1,5-dien-1-yl)-3-(2,5,7-trimethylocta-1,4,6-trien-3-yl)imidazolidine |
|---|---|
| PubChem CID | 123318542 |
| Molecular Formula | C24H38N2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 1-(2,4,5,6-tetramethylcyclohexa-1,5-dien-1-yl)-3-(2,5,7-trimethylocta-1,4,6-trien-3-yl)imidazolidine |
| SMILES | C=C(C)C(C=C(C)C=C(C)C)N1CCN(C2=C(C)CC(C)C(C)=C2C)C1 |
| InChI | InChI=1S/C24H38N2/c1-16(2)12-18(5)13-23(17(3)4)25-10-11-26(15-25)24-20(7)14-19(6)21(8)22(24)9/h12-13,19,23H,3,10-11,14-15H2,1-2,4-9H3 |
| InChIKey | DNBTUJRMJPRLFZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|