C20H13NO2 — CID 123318899
2-(phenyliminomethyl)cyclopenta[b]naphthalene-1,3-dione (PubChem CID 123318899) has the molecular formula C20H13NO2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-(phenyliminomethyl)cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-(phenyliminomethyl)cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 123318899 |
| Molecular Formula | C20H13NO2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(phenyliminomethyl)cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1c2cc3ccccc3cc2C(=O)C1/C=N/c1ccccc1 |
| InChI | InChI=1S/C20H13NO2/c22-19-16-10-13-6-4-5-7-14(13)11-17(16)20(23)18(19)12-21-15-8-2-1-3-9-15/h1-12,18H/b21-12+ |
| InChIKey | AGHDYCSPAVJXJB-CIAFOILYSA-N |
| XLogP | 4.24 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|