C25H37N5O2 — CID 123318961
1-aminoethyl 2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-6-methylquinoline-3-carboximidate (PubChem CID 123318961) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1-aminoethyl 2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-6-methylquinoline-3-carboximidate.
| Compound Name | 1-aminoethyl 2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-6-methylquinoline-3-carboximidate |
|---|---|
| PubChem CID | 123318961 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 1-aminoethyl 2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-6-methylquinoline-3-carboximidate |
| SMILES | [H]/N=C(\OC(C)N)c1cc2cc(C)ccc2nc1N1CCC(NC2CCCCC2)C(OC)C1 |
| InChI | InChI=1S/C25H37N5O2/c1-16-9-10-21-18(13-16)14-20(24(27)32-17(2)26)25(29-21)30-12-11-22(23(15-30)31-3)28-19-7-5-4-6-8-19/h9-10,13-14,17,19,22-23,27-28H,4-8,11-12,15,26H2,1-3H3/b27-24- |
| InChIKey | AJWQQDOMHPVBRY-PNHLSOANSA-N |
| XLogP | 3.71 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|