C33H20F4N4O — CID 123319118
3-[6-[9-[6-(2,6-difluoro-3,4-dihydropyridin-5-yl)-2-pyridinyl]xanthen-9-yl]-2-pyridinyl]-2,6-difluoropyridine (PubChem CID 123319118) has the molecular formula C33H20F4N4O and a molecular weight of 564.54 g/mol. Its IUPAC name is 3-[6-[9-[6-(2,6-difluoro-3,4-dihydropyridin-5-yl)-2-pyridinyl]xanthen-9-yl]-2-pyridinyl]-2,6-difluoropyridine.
| Compound Name | 3-[6-[9-[6-(2,6-difluoro-3,4-dihydropyridin-5-yl)-2-pyridinyl]xanthen-9-yl]-2-pyridinyl]-2,6-difluoropyridine |
|---|---|
| PubChem CID | 123319118 |
| Molecular Formula | C33H20F4N4O |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 3-[6-[9-[6-(2,6-difluoro-3,4-dihydropyridin-5-yl)-2-pyridinyl]xanthen-9-yl]-2-pyridinyl]-2,6-difluoropyridine |
| SMILES | FC1=NC(F)=C(c2cccc(C3(c4cccc(-c5ccc(F)nc5F)n4)c4ccccc4Oc4ccccc43)n2)CC1 |
| InChI | InChI=1S/C33H20F4N4O/c34-29-17-15-19(31(36)40-29)23-9-5-13-27(38-23)33(21-7-1-3-11-25(21)42-26-12-4-2-8-22(26)33)28-14-6-10-24(39-28)20-16-18-30(35)41-32(20)37/h1-15,17H,16,18H2 |
| InChIKey | BUKCKFZBHXNWLO-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|