About 4-methoxycyclohepta-2,4-dien-1-imine
4-methoxycyclohepta-2,4-dien-1-imine (PubChem CID 123319191) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 4-methoxycyclohepta-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 4-methoxycyclohepta-2,4-dien-1-imine |
| PubChem CID | 123319191 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 4-methoxycyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=CC(OC)=CCC1 |
| InChI | InChI=1S/C8H11NO/c1-10-8-4-2-3-7(9)5-6-8/h4-6,9H,2-3H2,1H3/b9-7+ |
| InChIKey | IUZONUYWNNZMLR-VQHVLOKHSA-N |
| XLogP | 1.89 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxycyclohepta-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycyclohepta-2,4-dien-1-imine?
The IUPAC name of 4-methoxycyclohepta-2,4-dien-1-imine (CID 123319191) is 4-methoxycyclohepta-2,4-dien-1-imine.
What is the SMILES notation for 4-methoxycyclohepta-2,4-dien-1-imine?
The canonical SMILES for 4-methoxycyclohepta-2,4-dien-1-imine is [H]/N=C1/C=CC(OC)=CCC1.
What is the InChIKey of 4-methoxycyclohepta-2,4-dien-1-imine?
The InChIKey is IUZONUYWNNZMLR-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H11NO/c1-10-8-4-2-3-7(9)5-6-8/h4-6,9H,2-3H2,1H3/b9-7+.
What are the key properties of 4-methoxycyclohepta-2,4-dien-1-imine?
4-methoxycyclohepta-2,4-dien-1-imine has a molecular weight of 137.18 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycyclohepta-2,4-dien-1-imine is sourced from PubChem (CID 123319191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).