C32H43ClN5O6+ — CID 123319321
methyl (2R,4R)-4-(3-chloroquinoxalin-2-yl)oxy-1-[(2S)-2-cyclopentyl-2-[[(3S)-3-pent-4-enoxypyrrolidine-1-carbonyl]amino]acetyl]-2-methylpyrrolidin-1-ium-1-carboxylate (PubChem CID 123319321) has the molecular formula C32H43ClN5O6+ and a molecular weight of 629.18 g/mol. Its IUPAC name is methyl (2R,4R)-4-(3-chloroquinoxalin-2-yl)oxy-1-[(2S)-2-cyclopentyl-2-[[(3S)-3-pent-4-enoxypyrrolidine-1-carbonyl]amino]acetyl]-2-methylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | methyl (2R,4R)-4-(3-chloroquinoxalin-2-yl)oxy-1-[(2S)-2-cyclopentyl-2-[[(3S)-3-pent-4-enoxypyrrolidine-1-carbonyl]amino]acetyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 123319321 |
| Molecular Formula | C32H43ClN5O6+ |
| Molecular Weight | 629.18 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | methyl (2R,4R)-4-(3-chloroquinoxalin-2-yl)oxy-1-[(2S)-2-cyclopentyl-2-[[(3S)-3-pent-4-enoxypyrrolidine-1-carbonyl]amino]acetyl]-2-methylpyrrolidin-1-ium-1-carboxylate |
| SMILES | C=CCCCO[C@H]1CCN(C(=O)N[C@H](C(=O)[N+]2(C(=O)OC)C[C@H](Oc3nc4ccccc4nc3Cl)C[C@H]2C)C2CCCC2)C1 |
| InChI | InChI=1S/C32H42ClN5O6/c1-4-5-10-17-43-23-15-16-37(19-23)31(40)36-27(22-11-6-7-12-22)30(39)38(32(41)42-3)20-24(18-21(38)2)44-29-28(33)34-25-13-8-9-14-26(25)35-29/h4,8-9,13-14,21-24,27H,1,5-7,10-12,15-20H2,2-3H3/p+1/t21-,23+,24-,27+,38?/m1/s1 |
| InChIKey | UKWIQOIUWDLCII-VZGZVUFXSA-O |
| XLogP | 5.26 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.18 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|