About 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one
8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one (PubChem CID 123320344) has the molecular formula C7H4O2
and a molecular weight of 120.11 g/mol. Its IUPAC name is 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one.
Molecular Properties
| Compound Name | 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one |
| PubChem CID | 123320344 |
| Molecular Formula | C7H4O2 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one |
| SMILES | O=c1cc2ccc(c1)o2 |
| InChI | InChI=1S/C7H4O2/c8-5-3-6-1-2-7(4-5)9-6/h1-4H |
| InChIKey | DIXBPLUGNBMHCS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one?
The IUPAC name of 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one (CID 123320344) is 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one.
What is the SMILES notation for 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one?
The canonical SMILES for 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one is O=c1cc2ccc(c1)o2.
What is the InChIKey of 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one?
The InChIKey is DIXBPLUGNBMHCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4O2/c8-5-3-6-1-2-7(4-5)9-6/h1-4H.
What are the key properties of 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one?
8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one has a molecular weight of 120.11 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxabicyclo[3.2.1]octa-1,4,6-trien-3-one is sourced from PubChem (CID 123320344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).