About 4-piperidin-1-yl-3,4-dihydropyridine
4-piperidin-1-yl-3,4-dihydropyridine (PubChem CID 123320641) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-piperidin-1-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 4-piperidin-1-yl-3,4-dihydropyridine |
| PubChem CID | 123320641 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 4-piperidin-1-yl-3,4-dihydropyridine |
| SMILES | C1=CC(N2CCCCC2)CC=N1 |
| InChI | InChI=1S/C10H16N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10/h4,6-7,10H,1-3,5,8-9H2 |
| InChIKey | DPNOOVMYNICZKK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-piperidin-1-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-1-yl-3,4-dihydropyridine?
The IUPAC name of 4-piperidin-1-yl-3,4-dihydropyridine (CID 123320641) is 4-piperidin-1-yl-3,4-dihydropyridine.
What is the SMILES notation for 4-piperidin-1-yl-3,4-dihydropyridine?
The canonical SMILES for 4-piperidin-1-yl-3,4-dihydropyridine is C1=CC(N2CCCCC2)CC=N1.
What is the InChIKey of 4-piperidin-1-yl-3,4-dihydropyridine?
The InChIKey is DPNOOVMYNICZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10/h4,6-7,10H,1-3,5,8-9H2.
What are the key properties of 4-piperidin-1-yl-3,4-dihydropyridine?
4-piperidin-1-yl-3,4-dihydropyridine has a molecular weight of 164.25 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-1-yl-3,4-dihydropyridine is sourced from PubChem (CID 123320641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).