C27H35F5N6O5Si — CID 123320654
methyl 2,2-dimethyl-3-[[4-methyl-5-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyrimidin-5-yl]-2-pyridinyl]oxy]propanoate (PubChem CID 123320654) has the molecular formula C27H35F5N6O5Si and a molecular weight of 646.69 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[[4-methyl-5-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyrimidin-5-yl]-2-pyridinyl]oxy]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[[4-methyl-5-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyrimidin-5-yl]-2-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 123320654 |
| Molecular Formula | C27H35F5N6O5Si |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | methyl 2,2-dimethyl-3-[[4-methyl-5-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyrimidin-5-yl]-2-pyridinyl]oxy]propanoate |
| SMILES | COC(=O)C(C)(C)COc1cc(C)c(-c2cnc(-c3nc(OCC(F)(F)C(F)(F)F)n(COCC[Si](C)(C)C)n3)nc2)cn1 |
| InChI | InChI=1S/C27H35F5N6O5Si/c1-17-10-20(42-14-25(2,3)23(39)40-4)33-13-19(17)18-11-34-21(35-12-18)22-36-24(43-15-26(28,29)27(30,31)32)38(37-22)16-41-8-9-44(5,6)7/h10-13H,8-9,14-16H2,1-7H3 |
| InChIKey | JFSLZQKXSIQAPV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 123.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|