C30H40N4O4Si — CID 123320825
methyl 2-[4-[5-[4-[5-ethoxy-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]cyclohex-3-en-1-yl]acetate (PubChem CID 123320825) has the molecular formula C30H40N4O4Si and a molecular weight of 548.76 g/mol. Its IUPAC name is methyl 2-[4-[5-[4-[5-ethoxy-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]cyclohex-3-en-1-yl]acetate.
| Compound Name | methyl 2-[4-[5-[4-[5-ethoxy-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]cyclohex-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 123320825 |
| Molecular Formula | C30H40N4O4Si |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | methyl 2-[4-[5-[4-[5-ethoxy-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]cyclohex-3-en-1-yl]acetate |
| SMILES | CCOc1nc(-c2ccc(-c3ccc(C4=CCC(CC(=O)OC)CC4)nc3)cc2)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C30H40N4O4Si/c1-6-38-30-32-29(34(33-30)21-37-17-18-39(3,4)5)25-13-11-23(12-14-25)26-15-16-27(31-20-26)24-9-7-22(8-10-24)19-28(35)36-2/h9,11-16,20,22H,6-8,10,17-19,21H2,1-5H3 |
| InChIKey | IIEVOBUTOIPEKU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|