C22H37Cl2NO2Si — CID 123321199
2-(2,6-dichloro-4-methoxyphenyl)-N-[(3,3-dimethylcyclobutyl)methyl]-2-triethylsilyloxyethanamine (PubChem CID 123321199) has the molecular formula C22H37Cl2NO2Si and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-methoxyphenyl)-N-[(3,3-dimethylcyclobutyl)methyl]-2-triethylsilyloxyethanamine.
| Compound Name | 2-(2,6-dichloro-4-methoxyphenyl)-N-[(3,3-dimethylcyclobutyl)methyl]-2-triethylsilyloxyethanamine |
|---|---|
| PubChem CID | 123321199 |
| Molecular Formula | C22H37Cl2NO2Si |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-(2,6-dichloro-4-methoxyphenyl)-N-[(3,3-dimethylcyclobutyl)methyl]-2-triethylsilyloxyethanamine |
| SMILES | CC[Si](CC)(CC)OC(CNCC1CC(C)(C)C1)c1c(Cl)cc(OC)cc1Cl |
| InChI | InChI=1S/C22H37Cl2NO2Si/c1-7-28(8-2,9-3)27-20(15-25-14-16-12-22(4,5)13-16)21-18(23)10-17(26-6)11-19(21)24/h10-11,16,20,25H,7-9,12-15H2,1-6H3 |
| InChIKey | ALQKOLIZFBQAIM-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|