C22H17NO7 — CID 123321362
[4-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)phenyl] 3,4,5-trihydroxybenzoate (PubChem CID 123321362) has the molecular formula C22H17NO7 and a molecular weight of 407.38 g/mol. Its IUPAC name is [4-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)phenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)phenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 123321362 |
| Molecular Formula | C22H17NO7 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [4-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)phenyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1ccc(-n2c(O)c3c(c2O)C2C=CC3C2)cc1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H17NO7/c24-15-8-12(9-16(25)19(15)26)22(29)30-14-5-3-13(4-6-14)23-20(27)17-10-1-2-11(7-10)18(17)21(23)28/h1-6,8-11,24-28H,7H2 |
| InChIKey | VHIRIFFALJFZSA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|