C15H23F9N2O6S3 — CID 123321391
3-(4-ethylazepan-1-yl)sulfonyl-1,1,2,2,3,3-hexafluoro-N-propyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide (PubChem CID 123321391) has the molecular formula C15H23F9N2O6S3 and a molecular weight of 594.54 g/mol. Its IUPAC name is 3-(4-ethylazepan-1-yl)sulfonyl-1,1,2,2,3,3-hexafluoro-N-propyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide.
| Compound Name | 3-(4-ethylazepan-1-yl)sulfonyl-1,1,2,2,3,3-hexafluoro-N-propyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 123321391 |
| Molecular Formula | C15H23F9N2O6S3 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.06 |
| IUPAC Name | 3-(4-ethylazepan-1-yl)sulfonyl-1,1,2,2,3,3-hexafluoro-N-propyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
| SMILES | CCCN(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCC(CC)CC1 |
| InChI | InChI=1S/C15H23F9N2O6S3/c1-3-8-26(35(31,32)15(22,23)24)34(29,30)14(20,21)12(16,17)13(18,19)33(27,28)25-9-5-6-11(4-2)7-10-25/h11H,3-10H2,1-2H3 |
| InChIKey | IMWXJTTVSUACKR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|