C48H60F3O15S- — CID 123321430
5-(3,5-dimethylbenzoyl)oxypentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;trifluoromethanesulfonate (PubChem CID 123321430) has the molecular formula C48H60F3O15S- and a molecular weight of 966.05 g/mol. Its IUPAC name is 5-(3,5-dimethylbenzoyl)oxypentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;trifluoromethanesulfonate.
| Compound Name | 5-(3,5-dimethylbenzoyl)oxypentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 123321430 |
| Molecular Formula | C48H60F3O15S- |
| Molecular Weight | 966.05 g/mol |
| Exact Mass | 965.36 |
| IUPAC Name | 5-(3,5-dimethylbenzoyl)oxypentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;trifluoromethanesulfonate |
| SMILES | Cc1cc(C)cc(C(=O)OCCCCCOC(=O)c2cc(C)cc(C)c2)c1.O=S(=O)([O-])C(F)(F)F.c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C24H32O8.C23H28O4.CHF3O3S/c1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;1-16-10-17(2)13-20(12-16)22(24)26-8-6-5-7-9-27-23(25)21-14-18(3)11-19(4)15-21;2-1(3,4)8(5,6)7/h1-8H,9-20H2;10-15H,5-9H2,1-4H3;(H,5,6,7)/p-1 |
| InChIKey | WVDYTHXTBIKBCV-UHFFFAOYSA-M |
| XLogP | 8.14 |
| TPSA | 183.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.05 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|