About 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine
5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine (PubChem CID 123321780) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine.
Molecular Properties
| Compound Name | 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine |
| PubChem CID | 123321780 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine |
| SMILES | C=Cc1c(SC)nnc(C)c1C |
| InChI | InChI=1S/C9H12N2S/c1-5-8-6(2)7(3)10-11-9(8)12-4/h5H,1H2,2-4H3 |
| InChIKey | PKLMNFCQZYXMEH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine?
The IUPAC name of 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine (CID 123321780) is 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine.
What is the SMILES notation for 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine?
The canonical SMILES for 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine is C=Cc1c(SC)nnc(C)c1C.
What is the InChIKey of 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine?
The InChIKey is PKLMNFCQZYXMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-5-8-6(2)7(3)10-11-9(8)12-4/h5H,1H2,2-4H3.
What are the key properties of 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine?
5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine has a molecular weight of 180.28 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-3,4-dimethyl-6-methylsulfanylpyridazine is sourced from PubChem (CID 123321780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).