C37H61F4NO2 — CID 123321791
[3-[2-(1-fluoroethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-4-methylcyclohexyl]-[[4-[[3-(4-methoxybutylidene)cyclopentyl]methyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol (PubChem CID 123321791) has the molecular formula C37H61F4NO2 and a molecular weight of 627.89 g/mol. Its IUPAC name is [3-[2-(1-fluoroethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-4-methylcyclohexyl]-[[4-[[3-(4-methoxybutylidene)cyclopentyl]methyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol.
| Compound Name | [3-[2-(1-fluoroethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-4-methylcyclohexyl]-[[4-[[3-(4-methoxybutylidene)cyclopentyl]methyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol |
|---|---|
| PubChem CID | 123321791 |
| Molecular Formula | C37H61F4NO2 |
| Molecular Weight | 627.89 g/mol |
| Exact Mass | 627.46 |
| IUPAC Name | [3-[2-(1-fluoroethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-4-methylcyclohexyl]-[[4-[[3-(4-methoxybutylidene)cyclopentyl]methyl]-3-(trifluoromethyl)cyclohexyl]amino]methanol |
| SMILES | COCCCC=C1CCC(CC2CCC(NC(O)C3CCC(C)C(C4C(C(C)F)CC5CCCCC54)C3)CC2C(F)(F)F)C1 |
| InChI | InChI=1S/C37H61F4NO2/c1-23-11-14-29(21-32(23)35-31-10-5-4-9-27(31)20-33(35)24(2)38)36(43)42-30-16-15-28(34(22-30)37(39,40)41)19-26-13-12-25(18-26)8-6-7-17-44-3/h8,23-24,26-36,42-43H,4-7,9-22H2,1-3H3 |
| InChIKey | WDCXOBJUKJGHSF-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.89 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|