C24H31F5N2O7S — CID 123321845
(2,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl) 3-[2-[2-[3-(3-butylsulfanyl-2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate (PubChem CID 123321845) has the molecular formula C24H31F5N2O7S and a molecular weight of 586.58 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl) 3-[2-[2-[3-(3-butylsulfanyl-2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl) 3-[2-[2-[3-(3-butylsulfanyl-2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 123321845 |
| Molecular Formula | C24H31F5N2O7S |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorocyclohexa-1,5-dien-1-yl) 3-[2-[2-[3-(3-butylsulfanyl-2,5-dihydroxypyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoate |
| SMILES | CCCCSc1cc(O)n(CCC(=O)NCCOCCOCCC(=O)OC2=C(F)C(F)C(F)C(F)=C2F)c1O |
| InChI | InChI=1S/C24H31F5N2O7S/c1-2-3-12-39-14-13-16(33)31(24(14)35)7-4-15(32)30-6-9-37-11-10-36-8-5-17(34)38-23-21(28)19(26)18(25)20(27)22(23)29/h13,18-19,33,35H,2-12H2,1H3,(H,30,32) |
| InChIKey | VZJREXLHCUPGCV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|