C14H11FN4O3 — CID 123321949
methyl 5-[(4-amino-5-fluoropyrimidin-2-yl)amino]-1-benzofuran-2-carboxylate (PubChem CID 123321949) has the molecular formula C14H11FN4O3 and a molecular weight of 302.27 g/mol. Its IUPAC name is methyl 5-[(4-amino-5-fluoropyrimidin-2-yl)amino]-1-benzofuran-2-carboxylate.
| Compound Name | methyl 5-[(4-amino-5-fluoropyrimidin-2-yl)amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 123321949 |
| Molecular Formula | C14H11FN4O3 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | methyl 5-[(4-amino-5-fluoropyrimidin-2-yl)amino]-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(Nc3ncc(F)c(N)n3)ccc2o1 |
| InChI | InChI=1S/C14H11FN4O3/c1-21-13(20)11-5-7-4-8(2-3-10(7)22-11)18-14-17-6-9(15)12(16)19-14/h2-6H,1H3,(H3,16,17,18,19) |
| InChIKey | LKKWBVWDJBBWKS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |