About N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide
N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide (PubChem CID 123322234) has the molecular formula C13H23NOS
and a molecular weight of 241.40 g/mol. Its IUPAC name is N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide.
Molecular Properties
| Compound Name | N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide |
| PubChem CID | 123322234 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide |
| SMILES | CC=CC(C)=C(C)CCC(C)=NS(=O)CC |
| InChI | InChI=1S/C13H23NOS/c1-6-8-11(3)12(4)9-10-13(5)14-16(15)7-2/h6,8H,7,9-10H2,1-5H3 |
| InChIKey | WGQBPGPFRGECLJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide?
The IUPAC name of N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide (CID 123322234) is N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide.
What is the SMILES notation for N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide?
The canonical SMILES for N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide is CC=CC(C)=C(C)CCC(C)=NS(=O)CC.
What is the InChIKey of N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide?
The InChIKey is WGQBPGPFRGECLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NOS/c1-6-8-11(3)12(4)9-10-13(5)14-16(15)7-2/h6,8H,7,9-10H2,1-5H3.
What are the key properties of N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide?
N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide has a molecular weight of 241.40 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dimethylnona-5,7-dien-2-ylidene)ethanesulfinamide is sourced from PubChem (CID 123322234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).