C25H33N5O2 — CID 123322471
4-[[6-imino-1-(4-prop-2-enoxypiperidine-1-carboximidoyl)-3-pyridinyl]oxymethyl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 123322471) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[[6-imino-1-(4-prop-2-enoxypiperidine-1-carboximidoyl)-3-pyridinyl]oxymethyl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 4-[[6-imino-1-(4-prop-2-enoxypiperidine-1-carboximidoyl)-3-pyridinyl]oxymethyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 123322471 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 4-[[6-imino-1-(4-prop-2-enoxypiperidine-1-carboximidoyl)-3-pyridinyl]oxymethyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | [H]/N=C(\N1CCC(OCC=C)CC1)n1cc(OCC2CCC(N)c3ccccc32)cc/c1=N\[H] |
| InChI | InChI=1S/C25H33N5O2/c1-2-15-31-19-11-13-29(14-12-19)25(28)30-16-20(8-10-24(30)27)32-17-18-7-9-23(26)22-6-4-3-5-21(18)22/h2-6,8,10,16,18-19,23,27-28H,1,7,9,11-15,17,26H2/b27-24+,28-25+ |
| InChIKey | CMTZDLNQQBQSJA-KNCIMYNLSA-N |
| XLogP | 3.37 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|