About N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine
N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine (PubChem CID 123322679) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine.
Analyze N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine?
The IUPAC name of N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine (CID 123322679) is N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine.
What is the SMILES notation for N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine?
The canonical SMILES for N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine is CNC1C=NCC(C)CC1C.
What is the InChIKey of N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine?
The InChIKey is AGKURXCQIKVHFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-7-4-8(2)9(10-3)6-11-5-7/h6-10H,4-5H2,1-3H3.
What are the key properties of N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine?
N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine has a molecular weight of 154.26 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3,5-trimethyl-3,4,5,6-tetrahydro-2H-azepin-6-amine is sourced from PubChem (CID 123322679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).