C25H28O4 — CID 123322780
(1Z,5S,7S,10R)-7,8,10,12-tetramethyl-4,20-dioxatetracyclo[16.2.2.12,5.05,10]tricosa-1,8,11,13,17,21-hexaene-3,23-dione (PubChem CID 123322780) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (1Z,5S,7S,10R)-7,8,10,12-tetramethyl-4,20-dioxatetracyclo[16.2.2.12,5.05,10]tricosa-1,8,11,13,17,21-hexaene-3,23-dione.
| Compound Name | (1Z,5S,7S,10R)-7,8,10,12-tetramethyl-4,20-dioxatetracyclo[16.2.2.12,5.05,10]tricosa-1,8,11,13,17,21-hexaene-3,23-dione |
|---|---|
| PubChem CID | 123322780 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (1Z,5S,7S,10R)-7,8,10,12-tetramethyl-4,20-dioxatetracyclo[16.2.2.12,5.05,10]tricosa-1,8,11,13,17,21-hexaene-3,23-dione |
| SMILES | CC1=C[C@@]2(C)C=C(C)[C@@H](C)C[C@]23OC(=O)/C(=C2/C=CC(=CCCC=C1)CO2)C3=O |
| InChI | InChI=1S/C25H28O4/c1-16-8-6-5-7-9-19-10-11-20(28-15-19)21-22(26)25(29-23(21)27)14-18(3)17(2)13-24(25,4)12-16/h6,8-13,18H,5,7,14-15H2,1-4H3/b8-6?,16-12?,19-9?,21-20+/t18-,24-,25+/m0/s1 |
| InChIKey | HFHJEHWFJWGNEW-SEGGUSBISA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|