C9H14FN — CID 123322899
7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine (PubChem CID 123322899) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine.
| Compound Name | 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine |
|---|---|
| PubChem CID | 123322899 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine |
| SMILES | CC1=CCCN(C)C(F)=C1C |
| InChI | InChI=1S/C9H14FN/c1-7-5-4-6-11(3)9(10)8(7)2/h5H,4,6H2,1-3H3 |
| InChIKey | KEHZCZINRLLXGA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|