About 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine
7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine (PubChem CID 123322899) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine.
Molecular Properties
| Compound Name | 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine |
| PubChem CID | 123322899 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine |
| SMILES | CC1=CCCN(C)C(F)=C1C |
| InChI | InChI=1S/C9H14FN/c1-7-5-4-6-11(3)9(10)8(7)2/h5H,4,6H2,1-3H3 |
| InChIKey | KEHZCZINRLLXGA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine?
The IUPAC name of 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine (CID 123322899) is 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine.
What is the SMILES notation for 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine?
The canonical SMILES for 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine is CC1=CCCN(C)C(F)=C1C.
What is the InChIKey of 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine?
The InChIKey is KEHZCZINRLLXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN/c1-7-5-4-6-11(3)9(10)8(7)2/h5H,4,6H2,1-3H3.
What are the key properties of 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine?
7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine has a molecular weight of 155.22 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1,5,6-trimethyl-2,3-dihydroazepine is sourced from PubChem (CID 123322899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).