C27H27N6O+ — CID 123322906
N-[3-(4-cyclobutyl-4-methyl-1,2,4-triazol-4-ium-3-yl)phenyl]-4-(6-cyclopropyl-3-pyridinyl)pyridine-2-carboxamide (PubChem CID 123322906) has the molecular formula C27H27N6O+ and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[3-(4-cyclobutyl-4-methyl-1,2,4-triazol-4-ium-3-yl)phenyl]-4-(6-cyclopropyl-3-pyridinyl)pyridine-2-carboxamide.
| Compound Name | N-[3-(4-cyclobutyl-4-methyl-1,2,4-triazol-4-ium-3-yl)phenyl]-4-(6-cyclopropyl-3-pyridinyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123322906 |
| Molecular Formula | C27H27N6O+ |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | N-[3-(4-cyclobutyl-4-methyl-1,2,4-triazol-4-ium-3-yl)phenyl]-4-(6-cyclopropyl-3-pyridinyl)pyridine-2-carboxamide |
| SMILES | C[N+]1(C2CCC2)C=NN=C1c1cccc(NC(=O)c2cc(-c3ccc(C4CC4)nc3)ccn2)c1 |
| InChI | InChI=1S/C27H26N6O/c1-33(23-6-3-7-23)17-30-32-26(33)20-4-2-5-22(14-20)31-27(34)25-15-19(12-13-28-25)21-10-11-24(29-16-21)18-8-9-18/h2,4-5,10-18,23H,3,6-9H2,1H3/p+1 |
| InChIKey | ZBZZSRVADAMHKG-UHFFFAOYSA-O |
| XLogP | 4.98 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|