About (6Z)-2-methyl-4,5-dihydroazocin-3-amine
(6Z)-2-methyl-4,5-dihydroazocin-3-amine (PubChem CID 123323292) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (6Z)-2-methyl-4,5-dihydroazocin-3-amine.
Molecular Properties
| Compound Name | (6Z)-2-methyl-4,5-dihydroazocin-3-amine |
| PubChem CID | 123323292 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (6Z)-2-methyl-4,5-dihydroazocin-3-amine |
| SMILES | CC1=C(N)CC/C=C\C=N/1 |
| InChI | InChI=1S/C8H12N2/c1-7-8(9)5-3-2-4-6-10-7/h2,4,6H,3,5,9H2,1H3/b4-2-,8-7?,10-6- |
| InChIKey | WKTYEFMHTIXNCS-UWHYAANUSA-N |
| XLogP | 1.60 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6Z)-2-methyl-4,5-dihydroazocin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-2-methyl-4,5-dihydroazocin-3-amine?
The IUPAC name of (6Z)-2-methyl-4,5-dihydroazocin-3-amine (CID 123323292) is (6Z)-2-methyl-4,5-dihydroazocin-3-amine.
What is the SMILES notation for (6Z)-2-methyl-4,5-dihydroazocin-3-amine?
The canonical SMILES for (6Z)-2-methyl-4,5-dihydroazocin-3-amine is CC1=C(N)CC/C=C\C=N/1.
What is the InChIKey of (6Z)-2-methyl-4,5-dihydroazocin-3-amine?
The InChIKey is WKTYEFMHTIXNCS-UWHYAANUSA-N. The full InChI is InChI=1S/C8H12N2/c1-7-8(9)5-3-2-4-6-10-7/h2,4,6H,3,5,9H2,1H3/b4-2-,8-7?,10-6-.
What are the key properties of (6Z)-2-methyl-4,5-dihydroazocin-3-amine?
(6Z)-2-methyl-4,5-dihydroazocin-3-amine has a molecular weight of 136.20 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-2-methyl-4,5-dihydroazocin-3-amine is sourced from PubChem (CID 123323292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).