C19H23FN6O — CID 123323334
(3-fluoropyrrolidin-1-yl)-[4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone (PubChem CID 123323334) has the molecular formula C19H23FN6O and a molecular weight of 370.43 g/mol. Its IUPAC name is (3-fluoropyrrolidin-1-yl)-[4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone.
| Compound Name | (3-fluoropyrrolidin-1-yl)-[4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 123323334 |
| Molecular Formula | C19H23FN6O |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (3-fluoropyrrolidin-1-yl)-[4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
| SMILES | CC1CCN(C(=O)N2CCC(F)C2)CC1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C19H23FN6O/c1-12-3-6-25(19(27)24-7-4-13(20)10-24)11-15(12)18-23-9-14-8-22-17-16(26(14)18)2-5-21-17/h2,5,8-9,12-13,15,21H,3-4,6-7,10-11H2,1H3 |
| InChIKey | LTVCGFNLVWEYFX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |