About N,2,3-trimethylcyclohexa-2,5-dien-1-imine
N,2,3-trimethylcyclohexa-2,5-dien-1-imine (PubChem CID 123323724) has the molecular formula C9H12N+
and a molecular weight of 134.20 g/mol. Its IUPAC name is N,2,3-trimethylcyclohexa-2,5-dien-1-imine.
Molecular Properties
| Compound Name | N,2,3-trimethylcyclohexa-2,5-dien-1-imine |
| PubChem CID | 123323724 |
| Molecular Formula | C9H12N+ |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.10 |
| IUPAC Name | N,2,3-trimethylcyclohexa-2,5-dien-1-imine |
| SMILES | C/N=C1\C=C[CH+]C(C)=C1C |
| InChI | InChI=1S/C9H12N/c1-7-5-4-6-9(10-3)8(7)2/h4-6H,1-3H3/q+1/b10-9+ |
| InChIKey | KALJQNKKSBOYIB-MDZDMXLPSA-N |
| XLogP | 2.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,2,3-trimethylcyclohexa-2,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2,3-trimethylcyclohexa-2,5-dien-1-imine?
The IUPAC name of N,2,3-trimethylcyclohexa-2,5-dien-1-imine (CID 123323724) is N,2,3-trimethylcyclohexa-2,5-dien-1-imine.
What is the SMILES notation for N,2,3-trimethylcyclohexa-2,5-dien-1-imine?
The canonical SMILES for N,2,3-trimethylcyclohexa-2,5-dien-1-imine is C/N=C1\C=C[CH+]C(C)=C1C.
What is the InChIKey of N,2,3-trimethylcyclohexa-2,5-dien-1-imine?
The InChIKey is KALJQNKKSBOYIB-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H12N/c1-7-5-4-6-9(10-3)8(7)2/h4-6H,1-3H3/q+1/b10-9+.
What are the key properties of N,2,3-trimethylcyclohexa-2,5-dien-1-imine?
N,2,3-trimethylcyclohexa-2,5-dien-1-imine has a molecular weight of 134.20 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2,3-trimethylcyclohexa-2,5-dien-1-imine is sourced from PubChem (CID 123323724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).