C18H20N9O2+ — CID 123323850
3-[[(2R)-1-amino-1-oxobutan-2-yl]amino]-5-[(3-cyano-1-methyl-3H-indol-1-ium-6-yl)amino]-1,2,4-triazine-6-carboxamide (PubChem CID 123323850) has the molecular formula C18H20N9O2+ and a molecular weight of 394.42 g/mol. Its IUPAC name is 3-[[(2R)-1-amino-1-oxobutan-2-yl]amino]-5-[(3-cyano-1-methyl-3H-indol-1-ium-6-yl)amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 3-[[(2R)-1-amino-1-oxobutan-2-yl]amino]-5-[(3-cyano-1-methyl-3H-indol-1-ium-6-yl)amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 123323850 |
| Molecular Formula | C18H20N9O2+ |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-[[(2R)-1-amino-1-oxobutan-2-yl]amino]-5-[(3-cyano-1-methyl-3H-indol-1-ium-6-yl)amino]-1,2,4-triazine-6-carboxamide |
| SMILES | CC[C@@H](Nc1nnc(C(N)=O)c(Nc2ccc3c(c2)[N+](C)=CC3C#N)n1)C(N)=O |
| InChI | InChI=1S/C18H19N9O2/c1-3-12(15(20)28)23-18-24-17(14(16(21)29)25-26-18)22-10-4-5-11-9(7-19)8-27(2)13(11)6-10/h4-6,8-9,12H,3H2,1-2H3,(H5-,20,21,22,23,24,26,28,29)/p+1/t9?,12-/m1/s1 |
| InChIKey | DCVAHTSAAIUYNG-FFFFSGIJSA-O |
| XLogP | 0.36 |
| TPSA | 175.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|