C24H30F3N5O4Si — CID 123323897
2,2-dimethyl-3-[[5-[6-[5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]-2-pyridinyl]oxy]propanoic acid (PubChem CID 123323897) has the molecular formula C24H30F3N5O4Si and a molecular weight of 537.62 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[5-[6-[5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]-2-pyridinyl]oxy]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[[5-[6-[5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]-2-pyridinyl]oxy]propanoic acid |
|---|---|
| PubChem CID | 123323897 |
| Molecular Formula | C24H30F3N5O4Si |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 2,2-dimethyl-3-[[5-[6-[5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-pyridinyl]-2-pyridinyl]oxy]propanoic acid |
| SMILES | CC(C)(COc1ccc(-c2ccc(-c3nc(C(F)(F)F)nn3COCC[Si](C)(C)C)nc2)cn1)C(=O)O |
| InChI | InChI=1S/C24H30F3N5O4Si/c1-23(2,22(33)34)14-36-19-9-7-17(13-29-19)16-6-8-18(28-12-16)20-30-21(24(25,26)27)31-32(20)15-35-10-11-37(3,4)5/h6-9,12-13H,10-11,14-15H2,1-5H3,(H,33,34) |
| InChIKey | UGMRPZYZRGDGDZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|