C22H46 — CID 123324624
3-ethyl-2,3,6,6,7,7,8,8,10-nonamethylundecane (PubChem CID 123324624) has the molecular formula C22H46 and a molecular weight of 310.61 g/mol. Its IUPAC name is 3-ethyl-2,3,6,6,7,7,8,8,10-nonamethylundecane.
| Compound Name | 3-ethyl-2,3,6,6,7,7,8,8,10-nonamethylundecane |
|---|---|
| PubChem CID | 123324624 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 3-ethyl-2,3,6,6,7,7,8,8,10-nonamethylundecane |
| SMILES | CCC(C)(CCC(C)(C)C(C)(C)C(C)(C)CC(C)C)C(C)C |
| InChI | InChI=1S/C22H46/c1-13-22(12,18(4)5)15-14-19(6,7)21(10,11)20(8,9)16-17(2)3/h17-18H,13-16H2,1-12H3 |
| InChIKey | XKABSJALXVPEOD-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |