C57H106Si10 — CID 123324851
tris[6-methyl-2,3,4-tris(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123324851) has the molecular formula C57H106Si10 and a molecular weight of 1072.33 g/mol. Its IUPAC name is tris[6-methyl-2,3,4-tris(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris[6-methyl-2,3,4-tris(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123324851 |
| Molecular Formula | C57H106Si10 |
| Molecular Weight | 1072.33 g/mol |
| Exact Mass | 1070.60 |
| IUPAC Name | tris[6-methyl-2,3,4-tris(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2c(C)cc([Si](C)(C)C)c([Si](C)(C)C)c2[Si](C)(C)C)(c2c(C)cc([Si](C)(C)C)c([Si](C)(C)C)c2[Si](C)(C)C)c2c(C)cc([Si](C)(C)C)c([Si](C)(C)C)c2[Si](C)(C)C)=C1C |
| InChI | InChI=1S/C57H106Si10/c1-38-35-45(58(8,9)10)52(61(17,18)19)55(64(26,27)28)48(38)67(51-43(6)41(4)42(5)44(51)7,49-39(2)36-46(59(11,12)13)53(62(20,21)22)56(49)65(29,30)31)50-40(3)37-47(60(14,15)16)54(63(23,24)25)57(50)66(32,33)34/h35-37,43H,1-34H3 |
| InChIKey | AOBHVBPWLAQRPE-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.33 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|