About 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid
3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid (PubChem CID 123324898) has the molecular formula C16H23N3O4S
and a molecular weight of 353.44 g/mol. Its IUPAC name is 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid |
| PubChem CID | 123324898 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid |
| SMILES | COc1cccc(-c2nn(COCCS(C)(C)C)cc2C(=O)O)n1 |
| InChI | InChI=1S/C16H23N3O4S/c1-22-14-7-5-6-13(17-14)15-12(16(20)21)10-19(18-15)11-23-8-9-24(2,3)4/h5-7,10H,8-9,11H2,1-4H3,(H,20,21) |
| InChIKey | NIURZZVEBVOHRA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid?
The IUPAC name of 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid (CID 123324898) is 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid.
What is the SMILES notation for 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid?
The canonical SMILES for 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid is COc1cccc(-c2nn(COCCS(C)(C)C)cc2C(=O)O)n1.
What is the InChIKey of 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid?
The InChIKey is NIURZZVEBVOHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O4S/c1-22-14-7-5-6-13(17-14)15-12(16(20)21)10-19(18-15)11-23-8-9-24(2,3)4/h5-7,10H,8-9,11H2,1-4H3,(H,20,21).
What are the key properties of 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid?
3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid has a molecular weight of 353.44 g/mol, XLogP of 2.32, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methoxy-2-pyridinyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrazole-4-carboxylic acid is sourced from PubChem (CID 123324898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).