C38H56FNO — CID 123325045
9-[6-amino-3-(3-ethyl-2-fluorocyclohexa-2,4-dien-1-yl)-5-(2-methylcyclopropyl)cyclohex-2-en-1-yl]-11-cyclohepta-1,3,6-trien-1-yl-2,10-dimethylundec-10-en-3-ol (PubChem CID 123325045) has the molecular formula C38H56FNO and a molecular weight of 561.87 g/mol. Its IUPAC name is 9-[6-amino-3-(3-ethyl-2-fluorocyclohexa-2,4-dien-1-yl)-5-(2-methylcyclopropyl)cyclohex-2-en-1-yl]-11-cyclohepta-1,3,6-trien-1-yl-2,10-dimethylundec-10-en-3-ol.
| Compound Name | 9-[6-amino-3-(3-ethyl-2-fluorocyclohexa-2,4-dien-1-yl)-5-(2-methylcyclopropyl)cyclohex-2-en-1-yl]-11-cyclohepta-1,3,6-trien-1-yl-2,10-dimethylundec-10-en-3-ol |
|---|---|
| PubChem CID | 123325045 |
| Molecular Formula | C38H56FNO |
| Molecular Weight | 561.87 g/mol |
| Exact Mass | 561.43 |
| IUPAC Name | 9-[6-amino-3-(3-ethyl-2-fluorocyclohexa-2,4-dien-1-yl)-5-(2-methylcyclopropyl)cyclohex-2-en-1-yl]-11-cyclohepta-1,3,6-trien-1-yl-2,10-dimethylundec-10-en-3-ol |
| SMILES | CCC1=C(F)C(C2=CC(C(CCCCCC(O)C(C)C)C(C)=CC3=CC=CCC=C3)C(N)C(C3CC3C)C2)CC=C1 |
| InChI | InChI=1S/C38H56FNO/c1-6-29-17-14-19-32(37(29)39)30-23-34(38(40)35(24-30)33-22-27(33)5)31(18-12-9-13-20-36(41)25(2)3)26(4)21-28-15-10-7-8-11-16-28/h7,10-11,14-17,21,23,25,27,31-36,38,41H,6,8-9,12-13,18-20,22,24,40H2,1-5H3 |
| InChIKey | JWPILTSWUMRVEZ-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.87 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|