About 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine
8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine (PubChem CID 123325411) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine.
Molecular Properties
| Compound Name | 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine |
| PubChem CID | 123325411 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine |
| SMILES | [H]/N=C(\CC)CC=CC=C(C)CC(C)C#CCC |
| InChI | InChI=1S/C16H25N/c1-5-7-10-14(3)13-15(4)11-8-9-12-16(17)6-2/h8-9,11,14,17H,5-6,12-13H2,1-4H3/b9-8?,15-11?,17-16+ |
| InChIKey | KUVUQMVDPFNXKA-OYWRXOSPSA-N |
| XLogP | 4.75 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine?
The IUPAC name of 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine (CID 123325411) is 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine.
What is the SMILES notation for 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine?
The canonical SMILES for 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine is [H]/N=C(\CC)CC=CC=C(C)CC(C)C#CCC.
What is the InChIKey of 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine?
The InChIKey is KUVUQMVDPFNXKA-OYWRXOSPSA-N. The full InChI is InChI=1S/C16H25N/c1-5-7-10-14(3)13-15(4)11-8-9-12-16(17)6-2/h8-9,11,14,17H,5-6,12-13H2,1-4H3/b9-8?,15-11?,17-16+.
What are the key properties of 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine?
8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine has a molecular weight of 231.38 g/mol, XLogP of 4.75, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,10-dimethyltetradeca-5,7-dien-11-yn-3-imine is sourced from PubChem (CID 123325411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).