C36H38Br2N2O3+2 — CID 123325546
1-[(2-bromo-5-methoxyphenyl)methyl]-4-[[1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethenylidene-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinolin-1-ium (PubChem CID 123325546) has the molecular formula C36H38Br2N2O3+2 and a molecular weight of 706.52 g/mol. Its IUPAC name is 1-[(2-bromo-5-methoxyphenyl)methyl]-4-[[1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethenylidene-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinolin-1-ium.
| Compound Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-4-[[1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethenylidene-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinolin-1-ium |
|---|---|
| PubChem CID | 123325546 |
| Molecular Formula | C36H38Br2N2O3+2 |
| Molecular Weight | 706.52 g/mol |
| Exact Mass | 704.12 |
| IUPAC Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-4-[[1-[(2-bromo-5-methoxyphenyl)methyl]-5-ethenylidene-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinolin-1-ium |
| SMILES | C=C=C1C[N+]2(Cc3cc(OC)ccc3Br)CCC1CC2Cc1cc[n+](Cc2cc(OC)ccc2Br)c2ccc(OC)cc12 |
| InChI | InChI=1S/C36H38Br2N2O3/c1-5-24-22-40(23-28-19-31(42-3)7-10-35(28)38)15-13-25(24)16-29(40)17-26-12-14-39(36-11-8-32(43-4)20-33(26)36)21-27-18-30(41-2)6-9-34(27)37/h6-12,14,18-20,25,29H,1,13,15-17,21-23H2,2-4H3/q+2 |
| InChIKey | COFVGWRMYYXJGW-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.52 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|