About 5-methyl-2,3-dimethylidenethiophene
5-methyl-2,3-dimethylidenethiophene (PubChem CID 123325824) has the molecular formula C7H8S
and a molecular weight of 124.21 g/mol. Its IUPAC name is 5-methyl-2,3-dimethylidenethiophene.
Molecular Properties
| Compound Name | 5-methyl-2,3-dimethylidenethiophene |
| PubChem CID | 123325824 |
| Molecular Formula | C7H8S |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 5-methyl-2,3-dimethylidenethiophene |
| SMILES | C=c1cc(C)sc1=C |
| InChI | InChI=1S/C7H8S/c1-5-4-6(2)8-7(5)3/h4H,1,3H2,2H3 |
| InChIKey | GJJJDDNZLBSPAB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2,3-dimethylidenethiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-dimethylidenethiophene?
The IUPAC name of 5-methyl-2,3-dimethylidenethiophene (CID 123325824) is 5-methyl-2,3-dimethylidenethiophene.
What is the SMILES notation for 5-methyl-2,3-dimethylidenethiophene?
The canonical SMILES for 5-methyl-2,3-dimethylidenethiophene is C=c1cc(C)sc1=C.
What is the InChIKey of 5-methyl-2,3-dimethylidenethiophene?
The InChIKey is GJJJDDNZLBSPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S/c1-5-4-6(2)8-7(5)3/h4H,1,3H2,2H3.
What are the key properties of 5-methyl-2,3-dimethylidenethiophene?
5-methyl-2,3-dimethylidenethiophene has a molecular weight of 124.21 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-dimethylidenethiophene is sourced from PubChem (CID 123325824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).