C22H24N4O4 — CID 123325887
8-N-(1,3-oxazol-2-ylmethyl)-6-N-(1-phenylpropyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide (PubChem CID 123325887) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 8-N-(1,3-oxazol-2-ylmethyl)-6-N-(1-phenylpropyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide.
| Compound Name | 8-N-(1,3-oxazol-2-ylmethyl)-6-N-(1-phenylpropyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide |
|---|---|
| PubChem CID | 123325887 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 8-N-(1,3-oxazol-2-ylmethyl)-6-N-(1-phenylpropyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-6,8-dicarboxamide |
| SMILES | CCC(NC(=O)c1cc(C(=O)NCc2ncco2)c2n1CCOC2)c1ccccc1 |
| InChI | InChI=1S/C22H24N4O4/c1-2-17(15-6-4-3-5-7-15)25-22(28)18-12-16(19-14-29-11-9-26(18)19)21(27)24-13-20-23-8-10-30-20/h3-8,10,12,17H,2,9,11,13-14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | HCKGJIYKCUNFGB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |