About 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one
5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one (PubChem CID 123326155) has the molecular formula C20H25N3O
and a molecular weight of 323.44 g/mol. Its IUPAC name is 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one.
Molecular Properties
| Compound Name | 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one |
| PubChem CID | 123326155 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc(N)c(NC(C)c3ccccc3)cc21 |
| InChI | InChI=1S/C20H25N3O/c1-5-23-18-12-17(22-13(2)14-9-7-6-8-10-14)16(21)11-15(18)20(3,4)19(23)24/h6-13,22H,5,21H2,1-4H3 |
| InChIKey | LDFPQAVRBXFVPI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one?
The IUPAC name of 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one (CID 123326155) is 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one.
What is the SMILES notation for 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one?
The canonical SMILES for 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one is CCN1C(=O)C(C)(C)c2cc(N)c(NC(C)c3ccccc3)cc21.
What is the InChIKey of 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one?
The InChIKey is LDFPQAVRBXFVPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O/c1-5-23-18-12-17(22-13(2)14-9-7-6-8-10-14)16(21)11-15(18)20(3,4)19(23)24/h6-13,22H,5,21H2,1-4H3.
What are the key properties of 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one?
5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one has a molecular weight of 323.44 g/mol, XLogP of 4.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-ethyl-3,3-dimethyl-6-(1-phenylethylamino)indol-2-one is sourced from PubChem (CID 123326155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).