About 3-methylpenta-1,2,4-trienylcyclopropane
3-methylpenta-1,2,4-trienylcyclopropane (PubChem CID 123326303) has the molecular formula C9H12
and a molecular weight of 120.19 g/mol. Its IUPAC name is 3-methylpenta-1,2,4-trienylcyclopropane.
Molecular Properties
| Compound Name | 3-methylpenta-1,2,4-trienylcyclopropane |
| PubChem CID | 123326303 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 3-methylpenta-1,2,4-trienylcyclopropane |
| SMILES | C=CC(C)=C=CC1CC1 |
| InChI | InChI=1S/C9H12/c1-3-8(2)4-5-9-6-7-9/h3,5,9H,1,6-7H2,2H3 |
| InChIKey | KPZZEIVNOPGYIN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpenta-1,2,4-trienylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpenta-1,2,4-trienylcyclopropane?
The IUPAC name of 3-methylpenta-1,2,4-trienylcyclopropane (CID 123326303) is 3-methylpenta-1,2,4-trienylcyclopropane.
What is the SMILES notation for 3-methylpenta-1,2,4-trienylcyclopropane?
The canonical SMILES for 3-methylpenta-1,2,4-trienylcyclopropane is C=CC(C)=C=CC1CC1.
What is the InChIKey of 3-methylpenta-1,2,4-trienylcyclopropane?
The InChIKey is KPZZEIVNOPGYIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12/c1-3-8(2)4-5-9-6-7-9/h3,5,9H,1,6-7H2,2H3.
What are the key properties of 3-methylpenta-1,2,4-trienylcyclopropane?
3-methylpenta-1,2,4-trienylcyclopropane has a molecular weight of 120.19 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpenta-1,2,4-trienylcyclopropane is sourced from PubChem (CID 123326303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).