About (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane
(6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane (PubChem CID 123326318) has the molecular formula C24H44
and a molecular weight of 332.62 g/mol. Its IUPAC name is (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane.
Molecular Properties
| Compound Name | (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane |
| PubChem CID | 123326318 |
| Molecular Formula | C24H44 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane |
| SMILES | C=C(C)C(C(CC(C)(C)C)C1CCCCC1)C(C(=C)C)C(C)(C)C |
| InChI | InChI=1S/C24H44/c1-17(2)21(22(18(3)4)24(8,9)10)20(16-23(5,6)7)19-14-12-11-13-15-19/h19-22H,1,3,11-16H2,2,4-10H3 |
| InChIKey | VVKGLTNUWGQCLS-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane?
The IUPAC name of (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane (CID 123326318) is (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane.
What is the SMILES notation for (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane?
The canonical SMILES for (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane is C=C(C)C(C(CC(C)(C)C)C1CCCCC1)C(C(=C)C)C(C)(C)C.
What is the InChIKey of (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane?
The InChIKey is VVKGLTNUWGQCLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44/c1-17(2)21(22(18(3)4)24(8,9)10)20(16-23(5,6)7)19-14-12-11-13-15-19/h19-22H,1,3,11-16H2,2,4-10H3.
What are the key properties of (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane?
(6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane has a molecular weight of 332.62 g/mol, XLogP of 8.05, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-tert-butyl-2,2,7-trimethyl-5-prop-1-en-2-yloct-7-en-4-yl)cyclohexane is sourced from PubChem (CID 123326318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).