About 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide
3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide (PubChem CID 123326464) has the molecular formula C12H24N4O2
and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide.
Molecular Properties
| Compound Name | 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide |
| PubChem CID | 123326464 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide |
| SMILES | C/N=C(/NC1CCC(O)C1)C(C)/C(N)=N/CCO |
| InChI | InChI=1S/C12H24N4O2/c1-8(11(13)15-5-6-17)12(14-2)16-9-3-4-10(18)7-9/h8-10,17-18H,3-7H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | IGJGNXZJQVMFBP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide?
The IUPAC name of 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide (CID 123326464) is 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide.
What is the SMILES notation for 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide?
The canonical SMILES for 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide is C/N=C(/NC1CCC(O)C1)C(C)/C(N)=N/CCO.
What is the InChIKey of 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide?
The InChIKey is IGJGNXZJQVMFBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O2/c1-8(11(13)15-5-6-17)12(14-2)16-9-3-4-10(18)7-9/h8-10,17-18H,3-7H2,1-2H3,(H2,13,15)(H,14,16).
What are the key properties of 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide?
3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide has a molecular weight of 256.35 g/mol, XLogP of -0.50, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(3-hydroxycyclopentyl)-1-N'-(2-hydroxyethyl)-3-N',2-dimethylpropanediimidamide is sourced from PubChem (CID 123326464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).