C22H26N3O2S+ — CID 123326757
4-[[5-(1-benzofuran-2-yl)-1,1-dimethyl-7aH-thieno[2,3-d]pyrimidin-1-ium-4-yl]oxy]cyclohexan-1-amine (PubChem CID 123326757) has the molecular formula C22H26N3O2S+ and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[[5-(1-benzofuran-2-yl)-1,1-dimethyl-7aH-thieno[2,3-d]pyrimidin-1-ium-4-yl]oxy]cyclohexan-1-amine.
| Compound Name | 4-[[5-(1-benzofuran-2-yl)-1,1-dimethyl-7aH-thieno[2,3-d]pyrimidin-1-ium-4-yl]oxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 123326757 |
| Molecular Formula | C22H26N3O2S+ |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-[[5-(1-benzofuran-2-yl)-1,1-dimethyl-7aH-thieno[2,3-d]pyrimidin-1-ium-4-yl]oxy]cyclohexan-1-amine |
| SMILES | C[N+]1(C)C=NC(OC2CCC(N)CC2)=C2C(c3cc4ccccc4o3)=CSC21 |
| InChI | InChI=1S/C22H26N3O2S/c1-25(2)13-24-21(26-16-9-7-15(23)8-10-16)20-17(12-28-22(20)25)19-11-14-5-3-4-6-18(14)27-19/h3-6,11-13,15-16,22H,7-10,23H2,1-2H3/q+1 |
| InChIKey | NEBLPEPQGWJYHG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|