C21H19ClF3N5O2 — CID 123326882
N-(1-aminoethylidene)-5-chloro-6-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]-3,6-dihydro-2H-pyridin-4-yl]pyridine-3-carboxamide (PubChem CID 123326882) has the molecular formula C21H19ClF3N5O2 and a molecular weight of 465.86 g/mol. Its IUPAC name is N-(1-aminoethylidene)-5-chloro-6-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]-3,6-dihydro-2H-pyridin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(1-aminoethylidene)-5-chloro-6-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]-3,6-dihydro-2H-pyridin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123326882 |
| Molecular Formula | C21H19ClF3N5O2 |
| Molecular Weight | 465.86 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-(1-aminoethylidene)-5-chloro-6-[1-[[4-(trifluoromethyl)phenyl]carbamoyl]-3,6-dihydro-2H-pyridin-4-yl]pyridine-3-carboxamide |
| SMILES | C/C(N)=N\C(=O)c1cnc(C2=CCN(C(=O)Nc3ccc(C(F)(F)F)cc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H19ClF3N5O2/c1-12(26)28-19(31)14-10-17(22)18(27-11-14)13-6-8-30(9-7-13)20(32)29-16-4-2-15(3-5-16)21(23,24)25/h2-6,10-11H,7-9H2,1H3,(H,29,32)(H2,26,28,31) |
| InChIKey | FPMCIXHMEVWHIP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|