About 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine
7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine (PubChem CID 123327159) has the molecular formula C23H18ClF2N
and a molecular weight of 381.85 g/mol. Its IUPAC name is 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine.
Molecular Properties
| Compound Name | 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine |
| PubChem CID | 123327159 |
| Molecular Formula | C23H18ClF2N |
| Molecular Weight | 381.85 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine |
| SMILES | CC1=CC2=CCC=CN2C=C1c1cccc(C)c1-c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C23H18ClF2N/c1-14-6-5-8-17(23(14)18-11-20(24)22(26)12-21(18)25)19-13-27-9-4-3-7-16(27)10-15(19)2/h4-13H,3H2,1-2H3 |
| InChIKey | HUTICCKYNXDDEY-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.85 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine?
The IUPAC name of 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine (CID 123327159) is 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine.
What is the SMILES notation for 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine?
The canonical SMILES for 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine is CC1=CC2=CCC=CN2C=C1c1cccc(C)c1-c1cc(Cl)c(F)cc1F.
What is the InChIKey of 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine?
The InChIKey is HUTICCKYNXDDEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClF2N/c1-14-6-5-8-17(23(14)18-11-20(24)22(26)12-21(18)25)19-13-27-9-4-3-7-16(27)10-15(19)2/h4-13H,3H2,1-2H3.
What are the key properties of 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine?
7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine has a molecular weight of 381.85 g/mol, XLogP of 7.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(5-chloro-2,4-difluorophenyl)-3-methylphenyl]-8-methyl-2H-quinolizine is sourced from PubChem (CID 123327159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).