C20H17F3N4O2 — CID 123327655
N-[amino-[6-methyl-2-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]methylidene]furan-3-carboxamide (PubChem CID 123327655) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is N-[amino-[6-methyl-2-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]methylidene]furan-3-carboxamide.
| Compound Name | N-[amino-[6-methyl-2-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]methylidene]furan-3-carboxamide |
|---|---|
| PubChem CID | 123327655 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[amino-[6-methyl-2-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]methylidene]furan-3-carboxamide |
| SMILES | Cc1ccc(/C(N)=N/C(=O)c2ccoc2)c(NCc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H17F3N4O2/c1-12-2-7-16(17(24)27-19(28)14-8-9-29-11-14)18(26-12)25-10-13-3-5-15(6-4-13)20(21,22)23/h2-9,11H,10H2,1H3,(H,25,26)(H2,24,27,28) |
| InChIKey | IEPXTXGWDKQJEV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|