C60H49N3 — CID 123327986
5-[3-(5-cyclohexa-1,3-dien-1-yl-7-cyclohexa-1,5-dien-1-yl-3,4-dihydro-2H-azepin-2-yl)phenyl]-9-phenyl-2-(9-phenyl-5,6-dihydrocarbazol-2-yl)carbazole (PubChem CID 123327986) has the molecular formula C60H49N3 and a molecular weight of 812.07 g/mol. Its IUPAC name is 5-[3-(5-cyclohexa-1,3-dien-1-yl-7-cyclohexa-1,5-dien-1-yl-3,4-dihydro-2H-azepin-2-yl)phenyl]-9-phenyl-2-(9-phenyl-5,6-dihydrocarbazol-2-yl)carbazole.
| Compound Name | 5-[3-(5-cyclohexa-1,3-dien-1-yl-7-cyclohexa-1,5-dien-1-yl-3,4-dihydro-2H-azepin-2-yl)phenyl]-9-phenyl-2-(9-phenyl-5,6-dihydrocarbazol-2-yl)carbazole |
|---|---|
| PubChem CID | 123327986 |
| Molecular Formula | C60H49N3 |
| Molecular Weight | 812.07 g/mol |
| Exact Mass | 811.39 |
| IUPAC Name | 5-[3-(5-cyclohexa-1,3-dien-1-yl-7-cyclohexa-1,5-dien-1-yl-3,4-dihydro-2H-azepin-2-yl)phenyl]-9-phenyl-2-(9-phenyl-5,6-dihydrocarbazol-2-yl)carbazole |
| SMILES | C1=CCCC(C2=CC(C3=CCCC=C3)=NC(c3cccc(-c4cccc5c4c4ccc(-c6ccc7c8c(n(-c9ccccc9)c7c6)C=CCC8)cc4n5-c4ccccc4)c3)CC2)=C1 |
| InChI | InChI=1S/C60H49N3/c1-5-17-41(18-6-1)43-33-36-54(61-55(38-43)42-19-7-2-8-20-42)47-22-15-21-46(37-47)50-28-16-30-57-60(50)53-35-32-45(40-59(53)63(57)49-25-11-4-12-26-49)44-31-34-52-51-27-13-14-29-56(51)62(58(52)39-44)48-23-9-3-10-24-48/h1,3-5,7,9-12,14-17,19-26,28-32,34-35,37-40,54H,2,6,8,13,18,27,33,36H2 |
| InChIKey | LSKLVBCDHKGYCG-UHFFFAOYSA-N |
| XLogP | 15.78 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.07 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |