C41H67NO14 — CID 123328343
acetic acid;2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]benzoic acid;2-ethylhexyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate (PubChem CID 123328343) has the molecular formula C41H67NO14 and a molecular weight of 797.98 g/mol. Its IUPAC name is acetic acid;2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]benzoic acid;2-ethylhexyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate.
| Compound Name | acetic acid;2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]benzoic acid;2-ethylhexyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate |
|---|---|
| PubChem CID | 123328343 |
| Molecular Formula | C41H67NO14 |
| Molecular Weight | 797.98 g/mol |
| Exact Mass | 797.46 |
| IUPAC Name | acetic acid;2-[2-(2,2-dimethylbutanoyloxy)ethoxycarbonyl]benzoic acid;2-ethylhexyl 6-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]hexanoate |
| SMILES | CC(=O)O.CCC(C)(C)C(=O)OCCOC(=O)c1ccccc1C(=O)O.CCCCC(CC)COC(=O)CCCCCOC(=O)NCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C23H43NO6.C16H20O6.C2H4O2/c1-6-9-13-19(7-2)18-30-20(25)14-11-10-12-16-29-22(27)24-15-17-28-21(26)23(4,5)8-3;1-4-16(2,3)15(20)22-10-9-21-14(19)12-8-6-5-7-11(12)13(17)18;1-2(3)4/h19H,6-18H2,1-5H3,(H,24,27);5-8H,4,9-10H2,1-3H3,(H,17,18);1H3,(H,3,4) |
| InChIKey | DPANYXLKOKWDES-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 218.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.98 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|