C13H17F3N4O2 — CID 123328411
N-hydroxy-2-methyl-3-[7-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]cyclopropane-1-carboxamide (PubChem CID 123328411) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is N-hydroxy-2-methyl-3-[7-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]cyclopropane-1-carboxamide.
| Compound Name | N-hydroxy-2-methyl-3-[7-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 123328411 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-hydroxy-2-methyl-3-[7-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]cyclopropane-1-carboxamide |
| SMILES | CC1C(C(=O)NO)C1c1cn2c(n1)CN(CC(F)(F)F)CC2 |
| InChI | InChI=1S/C13H17F3N4O2/c1-7-10(11(7)12(21)18-22)8-4-20-3-2-19(5-9(20)17-8)6-13(14,15)16/h4,7,10-11,22H,2-3,5-6H2,1H3,(H,18,21) |
| InChIKey | QURKAEWSWQYHEO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|