About (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate
(prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate (PubChem CID 123328435) has the molecular formula C14H18N4O4
and a molecular weight of 306.32 g/mol. Its IUPAC name is (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate.
Molecular Properties
| Compound Name | (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate |
| PubChem CID | 123328435 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate |
| SMILES | C=C(C)NOC(=O)Nc1ccccc1NC(=O)ONC(=C)C |
| InChI | InChI=1S/C14H18N4O4/c1-9(2)17-21-13(19)15-11-7-5-6-8-12(11)16-14(20)22-18-10(3)4/h5-8,17-18H,1,3H2,2,4H3,(H,15,19)(H,16,20) |
| InChIKey | WKIRGYHIPUCEAQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate?
The IUPAC name of (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate (CID 123328435) is (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate.
What is the SMILES notation for (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate?
The canonical SMILES for (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate is C=C(C)NOC(=O)Nc1ccccc1NC(=O)ONC(=C)C.
What is the InChIKey of (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate?
The InChIKey is WKIRGYHIPUCEAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O4/c1-9(2)17-21-13(19)15-11-7-5-6-8-12(11)16-14(20)22-18-10(3)4/h5-8,17-18H,1,3H2,2,4H3,(H,15,19)(H,16,20).
What are the key properties of (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate?
(prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate has a molecular weight of 306.32 g/mol, XLogP of 2.86, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (prop-1-en-2-ylamino) N-[2-[(prop-1-en-2-ylamino)oxycarbonylamino]phenyl]carbamate is sourced from PubChem (CID 123328435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).